Chemistry Homework Solutions

Suggest a method for the synthesis

Suggest a method for the synthesis of C6H5CH(OH)CH(OH)C6H5 from benzil, discuss the stereochemical aspects of this 1,2 diol.

Starting from triphenylphosphine, (C6H5)sP

Starting from triphenylphosphine, (C6H5)3P:, can you prepare the following ylide (C6H5)3P=C(CH3)CH2CH2CH3. If so show work, if not why not?

Diels-Alder reaction

Compounds containing carbon-carbon triple bond undergo the Diels-Alder reaction. Formulate the product formed by the reaction of (E,E)-1,4-dipjhenyl-1-3-butadiene with diethyl acetylenedicarboxylate. Show reaction.

IR Tables to distinguish between 1-butyne, 2-butyne, and 2-butene

Use IR tables to locate absorption bands of the stretching frequencies of the alkyne C - H bond, the alkyne C - (triple bond)- C , and the alkene C - H bond. Using this data, explain how you would distinguish between 1-butyne, 2-butyne, and 2-butene.

1,2-Dicarbonyl compounds

1,2-Dicarbonyl compounds such as benzil, can be characterized by reaction with o-phenylenediamine to form a substituted quinoxaline. See reaction below: Please see attached.

Write a complete mechanism & Outline a synthesis

A.) Write a complete mechanism for the addition of diethyl malonate to ethanal in the presence of base to form a beta-hydroxy ester. B.) Outline a sythensis that forms at least on C - C bond for each of the following compounds: 1.) CH3CH2CH2CH2CH2CH=CHCO2H 2.) CH3CH2CH2CH=C(CN)(CO2CH2CH3) Thanks

Equation for complete combustion e.g. butane

My chemistry book asks the question: Write the balanced equation for the complete combustion of each of the following compounds: a. ethane, C2 H6 The book has the answer which reads: 2C2h6 + 7O2 I don't understand where the formula for 7 02 b. cyclopropane I understand the formula C3H10 but I do ...continues

Knoevenagel Reaction

Give the structure of the products of the Knoevenagel reaction for the following pair of reactants: a.) Cyclopentanone + malonitrile (dicyanomethane) b.) Benzaldehyde + ethyl acetoacetate c.) Propanal + nitromethane

Bromination in methanol solvent

Cyclohexene undergoes bromination in methanol solvent to give trans-1-bromo-2-methoxycyclohexane. Draw a suitable mechanism to account for this.

Mixed aldol reaction

The mixed adol reaction between propionaldehyde and acetone gives an 85% yield of 4-hydroxy-2-hexanone when run in THF at -78 degrees C with lithium diisopropylamide (LDA is a powerful base). The reaction is carried out by first adding the ketone to the base, cooling the solution, and then adding the aldehyde. Please answer the ...continues

Browse